CAS 623175-24-6 appears in our catalog under these names: 4-Methyl-5-nitro-2-(pyridin-3-yl)pyridine, 95%, 4-Methyl-5-nitro-2,3'-bipyridine, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
4-methyl-5-nitro-2-pyridin-3-ylpyridine (CAS 623175-24-6) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 4-methyl-5-nitro-2-pyridin-3-ylpyridine. InChIKey: WMRKLFBOOLQJKN-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 4-methyl-5-nitro-2-pyridin-3-ylpyridine |
| InChIKey | WMRKLFBOOLQJKN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1[N+](=O)[O-])C2=CN=CC=C2 |
Computed by PubChem (NCBI)