CAS 6825-25-8 appears in our catalog under these names: 5-Nitro-N-phenylpyridin-2-amine, 95%, 5-Nitro-N-phenylpyridin-2-amine 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g.
5-nitro-N-phenylpyridin-2-amine (CAS 6825-25-8) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 5-nitro-N-phenylpyridin-2-amine. InChIKey: NIPKIXLTWQXXEE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 5-nitro-N-phenylpyridin-2-amine |
| InChIKey | NIPKIXLTWQXXEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)