Products 1019388-92-1

CAS 1019388-92-1 is the registry number for 2-(Pyridin-3-ylamino)isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(pyridin-3-ylamino)pyridine-4-carboxylic acid (CAS 1019388-92-1) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 2-(pyridin-3-ylamino)pyridine-4-carboxylic acid. InChIKey: FDINIMSIYYSFRS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9N3O2
Molecular weight215.21 g/mol
IUPAC name2-(pyridin-3-ylamino)pyridine-4-carboxylic acid
InChIKeyFDINIMSIYYSFRS-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)NC2=NC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)