cas: 1786-81-8 — see every product listed under this CAS number, including other names
2-(Propylamino)-o-propionotoluidide hydrochloride, 99%, 99% (CAS 1786-81-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11377D-5g |
| cas | 1786-81-8 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 170.00 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 100g | 1302.80 Pln | |
| Chemat | 25mg | 78.80 Pln | |
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 100mg | 88.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride (CAS 1786-81-8) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride. InChIKey: BJPJNTKRKALCPP-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O |
|---|---|
| Molecular weight | 256.77 g/mol |
| IUPAC name | N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride |
| InChIKey | BJPJNTKRKALCPP-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=CC=CC=C1C.Cl |
Computed by PubChem (NCBI)