cas: 1786-81-8 — see every product listed under this CAS number, including other names
Prilocaine hydrochloride, 99.00% (CAS 1786-81-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM03480P-10g |
| cas | 1786-81-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1010.90 Pln | |
| Chemat | 1g | 233.40 Pln | |
| Chemat | 5g | 589.25 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.00% |
| category | Chemicals |
N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride (CAS 1786-81-8) is a chemical compound with the molecular formula C13H21ClN2O and a molecular weight of 256.77 g/mol. IUPAC name: N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride. InChIKey: BJPJNTKRKALCPP-UHFFFAOYSA-N.
| Molecular formula | C13H21ClN2O |
|---|---|
| Molecular weight | 256.77 g/mol |
| IUPAC name | N-(2-methylphenyl)-2-(propylamino)propanamide;hydrochloride |
| InChIKey | BJPJNTKRKALCPP-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=CC=CC=C1C.Cl |
Computed by PubChem (NCBI)