cas: 3832-73-3 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)-dl-phenylalanine, 97% (CAS 3832-73-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007638-1G |
| cas | 3832-73-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 2059.71 Pln | |
| Fluorochem | 25g | 6016.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 3832-73-3) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: IOABLDGLYOGEHY-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | IOABLDGLYOGEHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)