CAS 130930-49-3 appears in our catalog under these names: 2-(Trifluoromethyl)-d-phenylalanine, 95%, 2–(Trifluoromethyl)–D–phenylalanine, (R)-2-Amino-3-(2-(trifluoromethyl)phenyl)propanoic acid, 98%, 98%, 2-(Trifluoromethyl)-D-phenylalanine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 10g.
(2R)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 130930-49-3) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: (2R)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: IOABLDGLYOGEHY-MRVPVSSYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | (2R)-2-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | IOABLDGLYOGEHY-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)