2-(Trifluoromethyl)oxazole-4-carboxylic acid, 95+%
cas: 1060816-01-4 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)oxazole-4-carboxylic acid, 95+% (CAS 1060816-01-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A517208-250mg |
| cas | 1060816-01-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2534.19 Pln | |
| Ambeed | 1g | 6533.62 Pln | |
| Chemat | 50mg | 755.60 Pln | |
| Chemat | 100mg | 1331.60 Pln | |
| Chemat | 250mg | 2320.40 Pln | |
| Chemat | 1g | 5982.80 Pln | |
| BLDpharm | 50mg | 814.18 Pln | |
| BLDpharm | 100mg | 1430.63 Pln | |
| BLDpharm | 250mg | 2491.37 Pln | |
| BLDpharm | 1g | 6406.66 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 1060816-01-4) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: MGJCQGMJTNTRSM-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | MGJCQGMJTNTRSM-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)