CAS 625120-14-1 appears in our catalog under these names: 5-(Trifluoromethyl)isoxazole-3-carboxylic acid, 5-(trifluoromethyl)-3-Isoxazolecarboxylic acid, 97%, 97%, 5-(Trifluoromethyl)isoxazole-3-carboxylic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg, 1g, 500mg.
5-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid (CAS 625120-14-1) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 5-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: GOSXXFNPBKFTNN-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | GOSXXFNPBKFTNN-UHFFFAOYSA-N |
| SMILES | C1=C(ON=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)