CAS 1432678-50-6 appears in our catalog under these names: 5-(Trifluoromethyl)-1,3-oxazole-4-carboxylic acid, 95%, 5-(Trifluoromethyl)-1,3-oxazole-4-carboxylic acid, 5-(Trifluoromethyl)-1,3-oxazole-4-carboxylic acid, >95%, >95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 1432678-50-6) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: XRRZHYACDZYENX-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | XRRZHYACDZYENX-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)