Products 1094702-34-7
CAS 1094702-34-7 appears in our catalog under these names: 5-(Trifluoromethyl)isoxazole-4-carboxylic acid, 95%, 5-(Trifluoromethyl)isoxazole-4-carboxylic acid, 96%, 5–(trifluoromethyl)isoxazole–4–carboxylic acid, 5-(Trifluoromethyl)isoxazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10mg, 0,25g.
5-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid (CAS 1094702-34-7) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 5-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid. InChIKey: XDUARVBJHGGPEP-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | XDUARVBJHGGPEP-UHFFFAOYSA-N |
| SMILES | C1=NOC(=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)