CAS 1076245-98-1 appears in our catalog under these names: 3-(Trifluoromethyl)isoxazole-4-carboxylic acid, 95%, 3-(Trifluoromethyl)isoxazole-4-carboxylic acid, 95+%, 3-(Trifluoromethyl)isoxazole-4-carboxylic Acid, >95% (HPLC), 3-(Trifluoromethyl)-1,2-oxazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, TRC, Biosynth. Available pack sizes: 250mg, 1g, 10g, 100mg, 10mg, 50mg, 0,5g.
3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid (CAS 1076245-98-1) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid. InChIKey: BUHQKFQUHDDTHL-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | BUHQKFQUHDDTHL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NO1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)