Products 1211580-23-2
CAS 1211580-23-2 appears in our catalog under these names: 4-(TRIFLUOROMETHYL)OXAZOLE-2-CARBOXYLIC ACID, >95%, 4-(Trifluoromethyl)oxazole-2-carboxylic acid, >95%, >95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(trifluoromethyl)-1,3-oxazole-2-carboxylic acid (CAS 1211580-23-2) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 4-(trifluoromethyl)-1,3-oxazole-2-carboxylic acid. InChIKey: HGXAYWNAZDZJIM-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1,3-oxazole-2-carboxylic acid |
| InChIKey | HGXAYWNAZDZJIM-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(O1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)