Products 1060816-01-4
CAS 1060816-01-4 is the registry number for 2-(Trifluoromethyl)oxazole-4-carboxylic acid, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 1060816-01-4) is a chemical compound with the molecular formula C5H2F3NO3 and a molecular weight of 181.07 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: MGJCQGMJTNTRSM-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO3 |
|---|---|
| Molecular weight | 181.07 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | MGJCQGMJTNTRSM-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(O1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)