cas: 110374-16-8 — see every product listed under this CAS number, including other names
2-[[(3,5-Dimethyl-2-pyridinyl)methyl]sulfinyl]-6-methoxy-1H-benzimidazole, 99%, 99% (CAS 110374-16-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148ZZ-1mg |
| cas | 110374-16-8 |
| size | 1mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 213.20 Pln | |
| Chemat | 5mg | 515.60 Pln | |
| Chemat | 10mg | 760.40 Pln | |
| Chemat | 100mg | 1461.20 Pln | |
| Chemat | 250mg | 2162.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole (CAS 110374-16-8) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole. InChIKey: ZMXZYNHJPJEPAE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole |
| InChIKey | ZMXZYNHJPJEPAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC)C |
Computed by PubChem (NCBI)