4-Desmethoxy Omeprazole, >95% (HPLC)
cas: 110374-16-8 — see every product listed under this CAS number, including other names
4-Desmethoxy Omeprazole, >95% (HPLC) (CAS 110374-16-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 5mg. Offered by: TRC.
| brand | TRC |
|---|---|
| catalog number | TRC-D290560-10MG |
| cas | 110374-16-8 |
| size | 10mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TRC | 10mg | price on request | |
| TRC | 50mg | price on request | |
| TRC | 5mg | price on request |
properties
| purity | >95% (HPLC) |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole (CAS 110374-16-8) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole. InChIKey: ZMXZYNHJPJEPAE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole |
| InChIKey | ZMXZYNHJPJEPAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC)C |
Computed by PubChem (NCBI)
Synonyms:
Omeprazole Impurity B, Omeprazole impurity B [EP], Omeprazole magnesium impurity B [EP], 1H-Benzimidazole, 2-(((3,5-dimethyl-2-pyridinyl)methyl)sulfinyl)-6-methoxy-, 2-((RS)-((3,5-Dimethylpyridin-2-yl)methyl)sulfinyl)-5-methoxy-1H-benzimidazole, OMEPRAZOLE IMPURITY B [EP IMPURITY], OMEPRAZOLE MAGNESIUM IMPURITY B [EP IMPURITY], OMEPRAZOLE IMPURITY B (EP IMPURITY), OMEPRAZOLE MAGNESIUM IMPURITY B (EP IMPURITY), Omeprazole magnesium impurity B