cas: 110374-16-8 — see every product listed under this CAS number, including other names
5-Methoxy-2-[[(3,5-dimethyl-2-pyridinyl)methyl]sulphinyl]-1H-benzimidazole (CAS 110374-16-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Roth.
| brand | Roth |
|---|---|
| catalog number | ROTH-2YC7.2 |
| cas | 110374-16-8 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Roth | 25mg | 1080.79 Pln | |
| Roth | 50mg | 1694.34 Pln | |
| Roth | 100mg | 2638.26 Pln | |
| Roth | 250mg | 5186.84 Pln |
| delivery time | 2 week |
|---|
2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole (CAS 110374-16-8) is a chemical compound with the molecular formula C16H17N3O2S and a molecular weight of 315.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole. InChIKey: ZMXZYNHJPJEPAE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-methoxy-1H-benzimidazole |
| InChIKey | ZMXZYNHJPJEPAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC)C |
Computed by PubChem (NCBI)