cas: 1611-03-6 — see every product listed under this CAS number, including other names
2-[3,5-Di(tert-butyl)-4-hydroxyphenyl]acetic acid, 97% (CAS 1611-03-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | BTB09885EA |
| cas | 1611-03-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 10g | 743.26 Pln | |
| Thermo Scientific | 25g | 1445.79 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(3,5-ditert-butyl-4-hydroxyphenyl)acetic acid (CAS 1611-03-6) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetic acid. InChIKey: QLMGIWHWWWXXME-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetic acid |
| InChIKey | QLMGIWHWWWXXME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CC(=O)O |
Computed by PubChem (NCBI)