CAS 2095678-97-8 appears in our catalog under these names: Propofol EP Impurity P, Isopropyl 4-Hydroxy-3,5-diisopropylbenzoate, >95% (HPLC), Propofol 4-Carboxylic Acid Isopropyl Ester, Isopropyl 4-hydroxy-3,5-diisopropylbenzoate, 95%, 95%, Isopropyl 4-hydroxy-3,5-diisopropylbenzoate, 98%. Offered by: Chemat Brand, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: on request, 100mg, 250mg, 2,5g, 1g, 5g.
Propan-2-yl 4-hydroxy-3,5-di(propan-2-yl)benzoate (CAS 2095678-97-8) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: propan-2-yl 4-hydroxy-3,5-di(propan-2-yl)benzoate. InChIKey: AQFMOBJQAQLNSL-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | propan-2-yl 4-hydroxy-3,5-di(propan-2-yl)benzoate |
| InChIKey | AQFMOBJQAQLNSL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C(=O)OC(C)C |
Computed by PubChem (NCBI)