cas: 2901-75-9 — see every product listed under this CAS number, including other names
2-Acetamido-3-phenylpropanoic acid, 98% (CAS 2901-75-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222930-5G |
| cas | 2901-75-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 320.74 Pln | |
| Fluorochem | 500g | 893.45 Pln | |
| Fluorochem | 1kg | 1528.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-acetylphenylalanine is the N-acetyl derivative of phenylalanine. It has a role as a metabolite and an antidepressant. It is a N-acetyl-amino acid and a phenylalanine derivative.
Source: ChEBI
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-acetamido-3-phenylpropanoic acid |
| InChIKey | CBQJSKKFNMDLON-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)