cas: 1765-42-0 — see every product listed under this CAS number, including other names
2-Amino-3,4,5,6-tetrafluorobenzoic acid, 98%, 98% (CAS 1765-42-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135PX-100mg |
| cas | 1765-42-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 3467.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-3,4,5,6-tetrafluorobenzoic acid (CAS 1765-42-0) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 2-amino-3,4,5,6-tetrafluorobenzoic acid. InChIKey: CNSGPAMLXMBLNA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 2-amino-3,4,5,6-tetrafluorobenzoic acid |
| InChIKey | CNSGPAMLXMBLNA-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)N)C(=O)O |
Computed by PubChem (NCBI)