CAS 65697-73-6 appears in our catalog under these names: (2,3,5,6-Tetrafluoro-4-pyridinyl)acetic acid, 95%, 2-(Perfluoropyridin-4-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg.
2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid (CAS 65697-73-6) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid. InChIKey: SOHLFVREHOCIMD-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetic acid |
| InChIKey | SOHLFVREHOCIMD-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=NC(=C1F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)