Products 1105988-64-4

CAS 1105988-64-4 is the registry number for 4-Fluoro-6-(trifluoromethyl)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1105988-64-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 4-fluoro-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: PWUMSLGVYHDUQG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3F4NO2
Molecular weight209.10 g/mol
IUPAC name4-fluoro-6-(trifluoromethyl)pyridine-3-carboxylic acid
InChIKeyPWUMSLGVYHDUQG-UHFFFAOYSA-N
SMILESC1=C(C(=CN=C1C(F)(F)F)C(=O)O)F

Computed by PubChem (NCBI)