CAS 944-43-4 appears in our catalog under these names: 4–Amino–2,3,5,6–tetrafluorobenzoic Acid, 4-Amino-2,3,5,6-tetrafluorobenzoic acid, 95%, 4-Amino-2,3,5,6-tetrafluorobenzoic acid, 97% , 4-Amino-2,3,5,6-tetrafluorobenzoic acid, ≥97%, 4-Amino-2,3,5,6-tetrafluorobenzoic acid, 98%. Offered by: GLPBio, Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
4-amino-2,3,5,6-tetrafluorobenzoic acid (CAS 944-43-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 4-amino-2,3,5,6-tetrafluorobenzoic acid. InChIKey: WTNSXWSOTDBWOR-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | WTNSXWSOTDBWOR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O |
Computed by PubChem (NCBI)