Products 886510-09-4
CAS 886510-09-4 appears in our catalog under these names: 3-Fluoro-2-trifluoromethyl-isonicotinic acid, 98%, 3-Fluoro-2-(trifluoromethyl)isonicotinic acid 98%, 3-fluoro(trifluoromethyl)isonicotinic acid, 98%, 98%, 3-Fluoro-2-trifluoromethyl-isonicotinic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100g, 25g, 100mg, 10g, 500mg.
3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 886510-09-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: GOYPFNAZTPCXGS-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | GOYPFNAZTPCXGS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)F)C(F)(F)F |
Computed by PubChem (NCBI)