CAS 1765-42-0 appears in our catalog under these names: 2-Amino-3,4,5,6-tetrafluorobenzoic acid, 95%, 2-Amino-3,4,5,6-tetrafluorobenzoic acid, 98%, 2-Amino-3,4,5,6-tetrafluorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2-amino-3,4,5,6-tetrafluorobenzoic acid (CAS 1765-42-0) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 2-amino-3,4,5,6-tetrafluorobenzoic acid. InChIKey: CNSGPAMLXMBLNA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 2-amino-3,4,5,6-tetrafluorobenzoic acid |
| InChIKey | CNSGPAMLXMBLNA-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)N)C(=O)O |
Computed by PubChem (NCBI)