Products 1211584-31-4
CAS 1211584-31-4 appears in our catalog under these names: 5-Fluoro-3-(trifluoromethyl)picolinic acid, 95%, 5-Fluoro-3-(trifluoromethyl)picolinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-fluoro-3-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1211584-31-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 5-fluoro-3-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: ATZASOVUCJTVCI-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 5-fluoro-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | ATZASOVUCJTVCI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)C(=O)O)F |
Computed by PubChem (NCBI)