cas: 53874-72-9 — see every product listed under this CAS number, including other names
2-Amino-3,5-dichlorobenzaldehyde, 97%, 97% (CAS 53874-72-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0M3-50mg |
| cas | 53874-72-9 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 534.80 Pln | |
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 250mg | 1086.80 Pln | |
| Chemat | 1g | 2627.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-3,5-dichlorobenzaldehyde (CAS 53874-72-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2-amino-3,5-dichlorobenzaldehyde. InChIKey: GTAKYWVLPLTYSK-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2-amino-3,5-dichlorobenzaldehyde |
| InChIKey | GTAKYWVLPLTYSK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)N)Cl)Cl |
Computed by PubChem (NCBI)