cas: 3032-32-4 — see every product listed under this CAS number, including other names
2-Amino-3,6-dichlorobenzoic acid, 95%, 95% (CAS 3032-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZRF-100mg |
| cas | 3032-32-4 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1288.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-3,6-dichlorobenzoic acid (CAS 3032-32-4) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2-amino-3,6-dichlorobenzoic acid. InChIKey: MMIREQFMYZQWLU-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2-amino-3,6-dichlorobenzoic acid |
| InChIKey | MMIREQFMYZQWLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C(=O)O)N)Cl |
Computed by PubChem (NCBI)