2-Amino-3-(3-chlorophenyl)propionic acid hydrochloride, 95%, 95%
cas: 120108-62-5 — see every product listed under this CAS number, including other names
2-Amino-3-(3-chlorophenyl)propionic acid hydrochloride, 95%, 95% (CAS 120108-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120YI4-1g |
| cas | 120108-62-5 |
| size | 1g |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1240.40 Pln | |
| Chemat | 5g | 2920.40 Pln | |
| Chemat | 10g | 4182.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride (CAS 120108-62-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride. InChIKey: MLKORXUFSMVSBB-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | MLKORXUFSMVSBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-(3-chlorophenyl)propanoic Acid Hydrochloride, 2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride, 2-amino-3-(3-chlorophenyl)propionic acid hydrochloride, H-Phe(3-Cl)-OH.HCl, 3-Chloro-L-phenylalanine hydrochloride, 3-Chlorophenylalanine--hydrogen chloride (1/1), 2-amino-3-(3-chlorophenyl)propanoic acid, chloride