cas: 24386-17-2 — see every product listed under this CAS number, including other names
2-Amino-3-cyano-4,5-di(fur-2-yl)furan, 97% (CAS 24386-17-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | NRB00495CB |
| cas | 24386-17-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 92.14 Pln | |
| Thermo Scientific | 1g | 210.25 Pln | |
| Thermo Scientific | 5g | 697.44 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-amino-4,5-bis(furan-2-yl)furan-3-carbonitrile (CAS 24386-17-2) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 2-amino-4,5-bis(furan-2-yl)furan-3-carbonitrile. InChIKey: RDQSOEAGWZLHBE-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-amino-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| InChIKey | RDQSOEAGWZLHBE-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(OC(=C2C#N)N)C3=CC=CO3 |
Computed by PubChem (NCBI)