2-Amino-4,5-dichlorobenzoic acid, 97%
cas: 20776-61-8 — see every product listed under this CAS number, including other names
2-Amino-4,5-dichlorobenzoic acid, 97% (CAS 20776-61-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113J0F-100mg |
| cas | 20776-61-8 |
| size | 100mg |
| availability | 175g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 688.40 Pln | |
| Chemat | 10g | 1182.80 Pln | |
| Chemat | 25g | 2022.80 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 2028.47 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-4,5-dichlorobenzoic acid (CAS 20776-61-8) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2-amino-4,5-dichlorobenzoic acid. InChIKey: MQWFRBVVABTUKS-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2-amino-4,5-dichlorobenzoic acid |
| InChIKey | MQWFRBVVABTUKS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)N)C(=O)O |
Computed by PubChem (NCBI)