cas: 20776-61-8 — see every product listed under this CAS number, including other names
2-Amino-4,5-dichlorobenzoic acid, 97% (CAS 20776-61-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079866-1G |
| cas | 20776-61-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 627.92 Pln | |
| Fluorochem | 10g | 1060.06 Pln | |
| Fluorochem | 25g | 1950.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-4,5-dichlorobenzoic acid (CAS 20776-61-8) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2-amino-4,5-dichlorobenzoic acid. InChIKey: MQWFRBVVABTUKS-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2-amino-4,5-dichlorobenzoic acid |
| InChIKey | MQWFRBVVABTUKS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)N)C(=O)O |
Computed by PubChem (NCBI)