cas: 31930-18-4 — see every product listed under this CAS number, including other names
2-Amino-4-nitrobenzamide, 97%, 97% (CAS 31930-18-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8JS-250mg |
| cas | 31930-18-4 |
| size | 250mg |
| availability | 22g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 10g | 573.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-nitrobenzamide (CAS 31930-18-4) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 2-amino-4-nitrobenzamide. InChIKey: FHIFCKSBNKKCJM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-amino-4-nitrobenzamide |
| InChIKey | FHIFCKSBNKKCJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)C(=O)N |
Computed by PubChem (NCBI)