cas: 13178-12-6 — see every product listed under this CAS number, including other names
2-Amino-5-(4-bromophenyl)-1,3,4-thiadiazole (CAS 13178-12-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033140-25G |
| cas | 13178-12-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 5402.28 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1289.15 Pln |
| delivery time | 3-4 weeks |
|---|
5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine (CAS 13178-12-6) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: KNFZBJVESBZZMI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KNFZBJVESBZZMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)Br |
Computed by PubChem (NCBI)