cas: 13178-12-6 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)-1,3,4-thiadiazol-2-amine, 99%(LC-MS),RG, 99%(LC-MS),RG (CAS 13178-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZQJ-250mg |
| cas | 13178-12-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 794.00 Pln | |
| Chemat | 25g | 3275.60 Pln |
| purity | 99%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine (CAS 13178-12-6) is a chemical compound with the molecular formula C8H6BrN3S and a molecular weight of 256.12 g/mol. IUPAC name: 5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: KNFZBJVESBZZMI-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3S |
|---|---|
| Molecular weight | 256.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KNFZBJVESBZZMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)Br |
Computed by PubChem (NCBI)