cas: 1094352-35-8 — see every product listed under this CAS number, including other names
2-Amino-5-fluoro-N,N-dimethylbenzamide 97% (CAS 1094352-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205439-100mg |
| cas | 1094352-35-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| Ambeed | 5g | 3079.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A205439 |
2-amino-5-fluoro-N,N-dimethylbenzamide (CAS 1094352-35-8) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 2-amino-5-fluoro-N,N-dimethylbenzamide. InChIKey: LSXZWDBINMAGOI-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-amino-5-fluoro-N,N-dimethylbenzamide |
| InChIKey | LSXZWDBINMAGOI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)