cas: 1094352-35-8 — see every product listed under this CAS number, including other names
2-amino-5-fluoro-N,N-dimethylbenzamide, 97%, 97% (CAS 1094352-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AF2Z-100mg |
| cas | 1094352-35-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 942.80 Pln | |
| Chemat | 5g | 2699.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-5-fluoro-N,N-dimethylbenzamide (CAS 1094352-35-8) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 2-amino-5-fluoro-N,N-dimethylbenzamide. InChIKey: LSXZWDBINMAGOI-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-amino-5-fluoro-N,N-dimethylbenzamide |
| InChIKey | LSXZWDBINMAGOI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)