cas: 1261676-58-7 — see every product listed under this CAS number, including other names
2-Amino-6-nitrobenzamide 95% (CAS 1261676-58-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A328923-100mg |
| cas | 1261676-58-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1972.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A328923 |
2-amino-6-nitrobenzamide (CAS 1261676-58-7) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 2-amino-6-nitrobenzamide. InChIKey: VSBVFLVLPDTKPJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-amino-6-nitrobenzamide |
| InChIKey | VSBVFLVLPDTKPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)N |
Computed by PubChem (NCBI)