cas: 1261676-58-7 — see every product listed under this CAS number, including other names
2-Amino-6-nitrobenzamide, 95%, 95% (CAS 1261676-58-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RYG-100mg |
| cas | 1261676-58-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 1893.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-6-nitrobenzamide (CAS 1261676-58-7) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 2-amino-6-nitrobenzamide. InChIKey: VSBVFLVLPDTKPJ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 2-amino-6-nitrobenzamide |
| InChIKey | VSBVFLVLPDTKPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)N)N |
Computed by PubChem (NCBI)