2-Aminobenzo[d]oxazole-6-carboxylic acid, 95%
cas: 1311315-81-7 — see every product listed under this CAS number, including other names
2-Aminobenzo[d]oxazole-6-carboxylic acid, 95% (CAS 1311315-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A798523-100mg |
| cas | 1311315-81-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1549.62 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1418.00 Pln | |
| BLDpharm | 100mg | 480.97 Pln | |
| BLDpharm | 250mg | 819.74 Pln | |
| BLDpharm | 1g | 1669.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-1,3-benzoxazole-6-carboxylic acid (CAS 1311315-81-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-amino-1,3-benzoxazole-6-carboxylic acid. InChIKey: YDSHCJMXVFSPNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-amino-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | YDSHCJMXVFSPNJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=N2)N |
Computed by PubChem (NCBI)