Products 1311315-81-7
CAS 1311315-81-7 appears in our catalog under these names: 2-Amino-1,3-benzoxazole-6-carboxylic acid, 98%, 2-Aminobenzo(d)oxazole-6-carboxylic acid, 98%, 2-Amino-1,3-benzoxazole-6-carboxylic acid, 2-Aminobenzo[d]oxazole-6-carboxylic acid, 95%, 95%, 2-Aminobenzo[d]oxazole-6-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 0,5g, 2g, 100mg.
2-amino-1,3-benzoxazole-6-carboxylic acid (CAS 1311315-81-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-amino-1,3-benzoxazole-6-carboxylic acid. InChIKey: YDSHCJMXVFSPNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-amino-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | YDSHCJMXVFSPNJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=N2)N |
Computed by PubChem (NCBI)