CAS 23814-14-4 appears in our catalog under these names: 2-Oxo-1,3-dihydro-1,3-benzodiazole-5-carboxylic acid, 98%, 2–Oxo–2,3–dihydro–1H–benzo(d)imidazole–5–carboxylic acid, 2-Oxo-2,3-dihydro-1H-benzimidazole-5-carboxylic acid, 98%, 2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 250mg.
2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid (CAS 23814-14-4) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid. InChIKey: YIGYJEWJHOCKSR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid |
| InChIKey | YIGYJEWJHOCKSR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)