Products 478553-83-2

CAS 478553-83-2 is the registry number for 2-Methyl-4-nitro-1,3-benzoxazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-methyl-4-nitro-1,3-benzoxazole (CAS 478553-83-2) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-methyl-4-nitro-1,3-benzoxazole. InChIKey: XREFCVYBUYJUNP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O3
Molecular weight178.14 g/mol
IUPAC name2-methyl-4-nitro-1,3-benzoxazole
InChIKeyXREFCVYBUYJUNP-UHFFFAOYSA-N
SMILESCC1=NC2=C(C=CC=C2O1)[N+](=O)[O-]

Computed by PubChem (NCBI)