CAS 20870-79-5 appears in our catalog under these names: 5-Nitrooxindole, 96%, 5-Nitroindolin-2-one 98%, 5-Nitroindolin-2-one, 95%, 5-Nitroindolin-2-one, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
5-nitro-1,3-dihydroindol-2-one (CAS 20870-79-5) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 5-nitro-1,3-dihydroindol-2-one. InChIKey: JQCGHRDKVZPCRO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-nitro-1,3-dihydroindol-2-one |
| InChIKey | JQCGHRDKVZPCRO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])NC1=O |
Computed by PubChem (NCBI)