CAS 32046-51-8 appears in our catalog under these names: 2-Methyl-5-nitro-1,3-benzoxazole, 97%, 2–Methyl–5–nitro–1,3–benzoxazole, 2-Methyl-5-nitro-1,3-benzoxazole, 2-Methyl-5-nitro-1,3-benzoxazole, 98%, 98%, 2-Methyl-5-nitro-1,3-benzoxazole, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-methyl-5-nitro-1,3-benzoxazole (CAS 32046-51-8) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-methyl-5-nitro-1,3-benzoxazole. InChIKey: UCZSXRHVXKAGFU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-methyl-5-nitro-1,3-benzoxazole |
| InChIKey | UCZSXRHVXKAGFU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)