Products 169044-97-7
CAS 169044-97-7 appears in our catalog under these names: 7-Nitroisoindolin-1-one, 97%, 97%, 7-Nitroisoindolin-1-one, 97%, 7-Nitro-2,3-dihydroisoindol-1-one, 95%. Offered by: Chemat, AmBeed, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
7-nitro-2,3-dihydroisoindol-1-one (CAS 169044-97-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 7-nitro-2,3-dihydroisoindol-1-one. InChIKey: LCDQMYJTXPCJLX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 7-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | LCDQMYJTXPCJLX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)