cas: 1394003-86-1 — see every product listed under this CAS number, including other names
2-Aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 97%, 97% (CAS 1394003-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AYD-100mg |
| cas | 1394003-86-1 |
| size | 100mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 918.80 Pln | |
| Chemat | 10g | 1619.60 Pln | |
| Chemat | 25g | 2997.20 Pln | |
| Chemat | 100g | 7874.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 1394003-86-1) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: RGVPAUFBNKASEL-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 2-aminopyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | RGVPAUFBNKASEL-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C(=N2)N)C(=O)O)N=C1 |
Computed by PubChem (NCBI)