cas: 102429-07-2 — see every product listed under this CAS number, including other names
2-Bromo-1-(2,4-difluorophenyl)ethanone 98% (CAS 102429-07-2) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A330862-25g |
| cas | 102429-07-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 220.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A330862 |
2-bromo-1-(2,4-difluorophenyl)ethanone (CAS 102429-07-2) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 2-bromo-1-(2,4-difluorophenyl)ethanone. InChIKey: CSGDTHXBRAAOHV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2-bromo-1-(2,4-difluorophenyl)ethanone |
| InChIKey | CSGDTHXBRAAOHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CBr |
Computed by PubChem (NCBI)