2-Bromo-1-(2-bromophenyl)ethanone, 95%
cas: 49851-55-0 — see every product listed under this CAS number, including other names
2-Bromo-1-(2-bromophenyl)ethanone, 95% (CAS 49851-55-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A279884-250mg |
| cas | 49851-55-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 10g | 743.06 Pln | |
| Ambeed | 25g | 1471.75 Pln | |
| Ambeed | 100g | 4725.81 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 236.61 Pln | |
| BLDpharm | 5g | 442.09 Pln | |
| BLDpharm | 10g | 791.97 Pln | |
| BLDpharm | 25g | 1580.58 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 711.23 Pln | |
| Fluorochem | 25g | 1513.03 Pln | |
| Fluorochem | 100g | 4824.36 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1-(2-bromophenyl)ethanone (CAS 49851-55-0) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(2-bromophenyl)ethanone. InChIKey: LAXPJIJQTHJGCK-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(2-bromophenyl)ethanone |
| InChIKey | LAXPJIJQTHJGCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)Br |
Computed by PubChem (NCBI)
Synonyms:
2-Bromophenacyl bromide, 2-bromo-1-(2-bromophenyl)ethanone, 2-Bromo-1-(2-bromophenyl)ethan-1-one, 2,2'-Dibromoacetophenone, 2-Bromo-1-(2-bromo-phenyl)-ethanone, 2-BromophenacylBromide, 2-Bromo-2'-bromoacetophenone, bromphenacyl bromide, Ethanone, 2-bromo-1-(2-bromophenyl)-, 2-Bromophenacylbromide90%