cas: 49851-55-0 — see every product listed under this CAS number, including other names
2-Bromo-1-(2-bromophenyl)ethanone, 95% (CAS 49851-55-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222833-1G |
| cas | 49851-55-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 10g | 674.78 Pln | |
| Fluorochem | 25g | 1601.54 Pln | |
| Fluorochem | 100g | 5449.14 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1-(2-bromophenyl)ethanone (CAS 49851-55-0) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(2-bromophenyl)ethanone. InChIKey: LAXPJIJQTHJGCK-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(2-bromophenyl)ethanone |
| InChIKey | LAXPJIJQTHJGCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)Br |
Computed by PubChem (NCBI)