cas: 49851-55-0 — see every product listed under this CAS number, including other names
2-Bromophenacylbromide, 96%, 96% (CAS 49851-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DAFY-100mg |
| cas | 49851-55-0 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 25g | 1192.40 Pln | |
| Chemat | 100g | 4518.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-(2-bromophenyl)ethanone (CAS 49851-55-0) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 2-bromo-1-(2-bromophenyl)ethanone. InChIKey: LAXPJIJQTHJGCK-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 2-bromo-1-(2-bromophenyl)ethanone |
| InChIKey | LAXPJIJQTHJGCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)Br |
Computed by PubChem (NCBI)